About N-[[(3S,4R)-1-acetyl-4-ethenylpyrrolidin-3-yl]methyl]-N-methylmethanesulfonamide
N-[[(3S,4R)-1-acetyl-4-ethenylpyrrolidin-3-yl]methyl]-N-methylmethanesulfonamide (PubChem CID 166684834) has the molecular formula C11H20N2O3S
and a molecular weight of 260.36 g/mol. Its IUPAC name is N-[[(3S,4R)-1-acetyl-4-ethenylpyrrolidin-3-yl]methyl]-N-methylmethanesulfonamide.
Molecular Properties
| Compound Name | N-[[(3S,4R)-1-acetyl-4-ethenylpyrrolidin-3-yl]methyl]-N-methylmethanesulfonamide |
| PubChem CID | 166684834 |
| Molecular Formula | C11H20N2O3S |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | N-[[(3S,4R)-1-acetyl-4-ethenylpyrrolidin-3-yl]methyl]-N-methylmethanesulfonamide |
| SMILES | C=C[C@H]1CN(C(C)=O)C[C@H]1CN(C)S(C)(=O)=O |
| InChI | InChI=1S/C11H20N2O3S/c1-5-10-7-13(9(2)14)8-11(10)6-12(3)17(4,15)16/h5,10-11H,1,6-8H2,2-4H3/t10-,11+/m0/s1 |
| InChIKey | VUTVWNNVRNGQHX-WDEREUQCSA-N |
| XLogP | 0.16 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[[(3S,4R)-1-acetyl-4-ethenylpyrrolidin-3-yl]methyl]-N-methylmethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(3S,4R)-1-acetyl-4-ethenylpyrrolidin-3-yl]methyl]-N-methylmethanesulfonamide?
The IUPAC name of N-[[(3S,4R)-1-acetyl-4-ethenylpyrrolidin-3-yl]methyl]-N-methylmethanesulfonamide (CID 166684834) is N-[[(3S,4R)-1-acetyl-4-ethenylpyrrolidin-3-yl]methyl]-N-methylmethanesulfonamide.
What is the SMILES notation for N-[[(3S,4R)-1-acetyl-4-ethenylpyrrolidin-3-yl]methyl]-N-methylmethanesulfonamide?
The canonical SMILES for N-[[(3S,4R)-1-acetyl-4-ethenylpyrrolidin-3-yl]methyl]-N-methylmethanesulfonamide is C=C[C@H]1CN(C(C)=O)C[C@H]1CN(C)S(C)(=O)=O.
What is the InChIKey of N-[[(3S,4R)-1-acetyl-4-ethenylpyrrolidin-3-yl]methyl]-N-methylmethanesulfonamide?
The InChIKey is VUTVWNNVRNGQHX-WDEREUQCSA-N. The full InChI is InChI=1S/C11H20N2O3S/c1-5-10-7-13(9(2)14)8-11(10)6-12(3)17(4,15)16/h5,10-11H,1,6-8H2,2-4H3/t10-,11+/m0/s1.
What are the key properties of N-[[(3S,4R)-1-acetyl-4-ethenylpyrrolidin-3-yl]methyl]-N-methylmethanesulfonamide?
N-[[(3S,4R)-1-acetyl-4-ethenylpyrrolidin-3-yl]methyl]-N-methylmethanesulfonamide has a molecular weight of 260.36 g/mol, XLogP of 0.16, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(3S,4R)-1-acetyl-4-ethenylpyrrolidin-3-yl]methyl]-N-methylmethanesulfonamide is sourced from PubChem (CID 166684834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).