C11H20N2O3S — CID 166684834
N-[[(3S,4R)-1-acetyl-4-ethenylpyrrolidin-3-yl]methyl]-N-methylmethanesulfonamide (PubChem CID 166684834) has the molecular formula C11H20N2O3S and a molecular weight of 260.36 g/mol. Its IUPAC name is N-[[(3S,4R)-1-acetyl-4-ethenylpyrrolidin-3-yl]methyl]-N-methylmethanesulfonamide.
| Compound Name | N-[[(3S,4R)-1-acetyl-4-ethenylpyrrolidin-3-yl]methyl]-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 166684834 |
| Molecular Formula | C11H20N2O3S |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | N-[[(3S,4R)-1-acetyl-4-ethenylpyrrolidin-3-yl]methyl]-N-methylmethanesulfonamide |
| SMILES | C=C[C@H]1CN(C(C)=O)C[C@H]1CN(C)S(C)(=O)=O |
| InChI | InChI=1S/C11H20N2O3S/c1-5-10-7-13(9(2)14)8-11(10)6-12(3)17(4,15)16/h5,10-11H,1,6-8H2,2-4H3/t10-,11+/m0/s1 |
| InChIKey | VUTVWNNVRNGQHX-WDEREUQCSA-N |
| XLogP | 0.16 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|