C30H34FN3O3S — CID 166686608
(2,5-dimethylphenyl)-[3-[3-[[2-(6-fluoro-3-pyridinyl)pyrrolidin-1-yl]sulfanylmethyl]phenoxy]-4-methoxypyrrolidin-1-yl]methanone (PubChem CID 166686608) has the molecular formula C30H34FN3O3S and a molecular weight of 535.69 g/mol. Its IUPAC name is (2,5-dimethylphenyl)-[3-[3-[[2-(6-fluoro-3-pyridinyl)pyrrolidin-1-yl]sulfanylmethyl]phenoxy]-4-methoxypyrrolidin-1-yl]methanone.
| Compound Name | (2,5-dimethylphenyl)-[3-[3-[[2-(6-fluoro-3-pyridinyl)pyrrolidin-1-yl]sulfanylmethyl]phenoxy]-4-methoxypyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 166686608 |
| Molecular Formula | C30H34FN3O3S |
| Molecular Weight | 535.69 g/mol |
| Exact Mass | 535.23 |
| IUPAC Name | (2,5-dimethylphenyl)-[3-[3-[[2-(6-fluoro-3-pyridinyl)pyrrolidin-1-yl]sulfanylmethyl]phenoxy]-4-methoxypyrrolidin-1-yl]methanone |
| SMILES | COC1CN(C(=O)c2cc(C)ccc2C)CC1Oc1cccc(CSN2CCCC2c2ccc(F)nc2)c1 |
| InChI | InChI=1S/C30H34FN3O3S/c1-20-9-10-21(2)25(14-20)30(35)33-17-27(36-3)28(18-33)37-24-7-4-6-22(15-24)19-38-34-13-5-8-26(34)23-11-12-29(31)32-16-23/h4,6-7,9-12,14-16,26-28H,5,8,13,17-19H2,1-3H3 |
| InChIKey | KTSUGDYIOSSSED-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.69 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|