C24H31N3O3S — CID 166686648
(2,5-dimethylphenyl)-[3-methoxy-4-[3-(pyrrolidin-1-ylsulfanylamino)phenoxy]pyrrolidin-1-yl]methanone (PubChem CID 166686648) has the molecular formula C24H31N3O3S and a molecular weight of 441.60 g/mol. Its IUPAC name is (2,5-dimethylphenyl)-[3-methoxy-4-[3-(pyrrolidin-1-ylsulfanylamino)phenoxy]pyrrolidin-1-yl]methanone.
| Compound Name | (2,5-dimethylphenyl)-[3-methoxy-4-[3-(pyrrolidin-1-ylsulfanylamino)phenoxy]pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 166686648 |
| Molecular Formula | C24H31N3O3S |
| Molecular Weight | 441.60 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | (2,5-dimethylphenyl)-[3-methoxy-4-[3-(pyrrolidin-1-ylsulfanylamino)phenoxy]pyrrolidin-1-yl]methanone |
| SMILES | COC1CN(C(=O)c2cc(C)ccc2C)CC1Oc1cccc(NSN2CCCC2)c1 |
| InChI | InChI=1S/C24H31N3O3S/c1-17-9-10-18(2)21(13-17)24(28)26-15-22(29-3)23(16-26)30-20-8-6-7-19(14-20)25-31-27-11-4-5-12-27/h6-10,13-14,22-23,25H,4-5,11-12,15-16H2,1-3H3 |
| InChIKey | RVPKCAXCIKPUMZ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.60 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|