C25H33N3O3S — CID 166686500
(2,5-dimethylphenyl)-[3-methoxy-4-[3-[(3-methylpyrrolidin-1-yl)sulfanylamino]phenoxy]pyrrolidin-1-yl]methanone (PubChem CID 166686500) has the molecular formula C25H33N3O3S and a molecular weight of 455.62 g/mol. Its IUPAC name is (2,5-dimethylphenyl)-[3-methoxy-4-[3-[(3-methylpyrrolidin-1-yl)sulfanylamino]phenoxy]pyrrolidin-1-yl]methanone.
| Compound Name | (2,5-dimethylphenyl)-[3-methoxy-4-[3-[(3-methylpyrrolidin-1-yl)sulfanylamino]phenoxy]pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 166686500 |
| Molecular Formula | C25H33N3O3S |
| Molecular Weight | 455.62 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | (2,5-dimethylphenyl)-[3-methoxy-4-[3-[(3-methylpyrrolidin-1-yl)sulfanylamino]phenoxy]pyrrolidin-1-yl]methanone |
| SMILES | COC1CN(C(=O)c2cc(C)ccc2C)CC1Oc1cccc(NSN2CCC(C)C2)c1 |
| InChI | InChI=1S/C25H33N3O3S/c1-17-8-9-19(3)22(12-17)25(29)27-15-23(30-4)24(16-27)31-21-7-5-6-20(13-21)26-32-28-11-10-18(2)14-28/h5-9,12-13,18,23-24,26H,10-11,14-16H2,1-4H3 |
| InChIKey | RUSZOZLKTLOJSN-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.62 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|