C20H29N3O3S — CID 166686444
1-[(3R)-3-[3-(3-azabicyclo[3.1.0]hexan-3-ylsulfanylamino)phenoxy]-4-methoxypyrrolidin-1-yl]-2-methylpropan-1-one (PubChem CID 166686444) has the molecular formula C20H29N3O3S and a molecular weight of 391.54 g/mol. Its IUPAC name is 1-[(3R)-3-[3-(3-azabicyclo[3.1.0]hexan-3-ylsulfanylamino)phenoxy]-4-methoxypyrrolidin-1-yl]-2-methylpropan-1-one.
| Compound Name | 1-[(3R)-3-[3-(3-azabicyclo[3.1.0]hexan-3-ylsulfanylamino)phenoxy]-4-methoxypyrrolidin-1-yl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 166686444 |
| Molecular Formula | C20H29N3O3S |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 1-[(3R)-3-[3-(3-azabicyclo[3.1.0]hexan-3-ylsulfanylamino)phenoxy]-4-methoxypyrrolidin-1-yl]-2-methylpropan-1-one |
| SMILES | COC1CN(C(=O)C(C)C)C[C@H]1Oc1cccc(NSN2CC3CC3C2)c1 |
| InChI | InChI=1S/C20H29N3O3S/c1-13(2)20(24)22-11-18(25-3)19(12-22)26-17-6-4-5-16(8-17)21-27-23-9-14-7-15(14)10-23/h4-6,8,13-15,18-19,21H,7,9-12H2,1-3H3/t14?,15?,18?,19-/m1/s1 |
| InChIKey | JXIHHSCRLFCSNL-LBOWEKIUSA-N |
| XLogP | 2.87 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|