C22H29N3O4S — CID 166686521
[(3R)-3-[3-(dimethylaminosulfanylamino)phenoxy]-4-methoxypyrrolidin-1-yl]-(2-methoxy-6-methylphenyl)methanone (PubChem CID 166686521) has the molecular formula C22H29N3O4S and a molecular weight of 431.56 g/mol. Its IUPAC name is [(3R)-3-[3-(dimethylaminosulfanylamino)phenoxy]-4-methoxypyrrolidin-1-yl]-(2-methoxy-6-methylphenyl)methanone.
| Compound Name | [(3R)-3-[3-(dimethylaminosulfanylamino)phenoxy]-4-methoxypyrrolidin-1-yl]-(2-methoxy-6-methylphenyl)methanone |
|---|---|
| PubChem CID | 166686521 |
| Molecular Formula | C22H29N3O4S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | [(3R)-3-[3-(dimethylaminosulfanylamino)phenoxy]-4-methoxypyrrolidin-1-yl]-(2-methoxy-6-methylphenyl)methanone |
| SMILES | COc1cccc(C)c1C(=O)N1CC(OC)[C@H](Oc2cccc(NSN(C)C)c2)C1 |
| InChI | InChI=1S/C22H29N3O4S/c1-15-8-6-11-18(27-4)21(15)22(26)25-13-19(28-5)20(14-25)29-17-10-7-9-16(12-17)23-30-24(2)3/h6-12,19-20,23H,13-14H2,1-5H3/t19?,20-/m1/s1 |
| InChIKey | ZBYLIAHPZDUXFP-GFOWMXPYSA-N |
| XLogP | 3.46 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|