C26H33N3O3S — CID 166686707
[3-[3-(5-azaspiro[2.4]heptan-5-ylsulfanylamino)phenoxy]-4-methoxypyrrolidin-1-yl]-(2,5-dimethylphenyl)methanone (PubChem CID 166686707) has the molecular formula C26H33N3O3S and a molecular weight of 467.64 g/mol. Its IUPAC name is [3-[3-(5-azaspiro[2.4]heptan-5-ylsulfanylamino)phenoxy]-4-methoxypyrrolidin-1-yl]-(2,5-dimethylphenyl)methanone.
| Compound Name | [3-[3-(5-azaspiro[2.4]heptan-5-ylsulfanylamino)phenoxy]-4-methoxypyrrolidin-1-yl]-(2,5-dimethylphenyl)methanone |
|---|---|
| PubChem CID | 166686707 |
| Molecular Formula | C26H33N3O3S |
| Molecular Weight | 467.64 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | [3-[3-(5-azaspiro[2.4]heptan-5-ylsulfanylamino)phenoxy]-4-methoxypyrrolidin-1-yl]-(2,5-dimethylphenyl)methanone |
| SMILES | COC1CN(C(=O)c2cc(C)ccc2C)CC1Oc1cccc(NSN2CCC3(CC3)C2)c1 |
| InChI | InChI=1S/C26H33N3O3S/c1-18-7-8-19(2)22(13-18)25(30)28-15-23(31-3)24(16-28)32-21-6-4-5-20(14-21)27-33-29-12-11-26(17-29)9-10-26/h4-8,13-14,23-24,27H,9-12,15-17H2,1-3H3 |
| InChIKey | MUKYJQAUKFQWBL-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.64 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|