About 3-[(E,2Z)-5-chloro-2-ethylidene-4-fluoropent-3-enyl]isoquinoline
3-[(E,2Z)-5-chloro-2-ethylidene-4-fluoropent-3-enyl]isoquinoline (PubChem CID 166687668) has the molecular formula C16H15ClFN
and a molecular weight of 275.75 g/mol. Its IUPAC name is 3-[(E,2Z)-5-chloro-2-ethylidene-4-fluoropent-3-enyl]isoquinoline.
Molecular Properties
| Compound Name | 3-[(E,2Z)-5-chloro-2-ethylidene-4-fluoropent-3-enyl]isoquinoline |
| PubChem CID | 166687668 |
| Molecular Formula | C16H15ClFN |
| Molecular Weight | 275.75 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 3-[(E,2Z)-5-chloro-2-ethylidene-4-fluoropent-3-enyl]isoquinoline |
| SMILES | C/C=C(\C=C(\F)CCl)Cc1cc2ccccc2cn1 |
| InChI | InChI=1S/C16H15ClFN/c1-2-12(7-15(18)10-17)8-16-9-13-5-3-4-6-14(13)11-19-16/h2-7,9,11H,8,10H2,1H3/b12-2+,15-7+ |
| InChIKey | CXPJCVVTQICAHE-VIKRKKPCSA-N |
| XLogP | 4.82 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.75 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(E,2Z)-5-chloro-2-ethylidene-4-fluoropent-3-enyl]isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(E,2Z)-5-chloro-2-ethylidene-4-fluoropent-3-enyl]isoquinoline?
The IUPAC name of 3-[(E,2Z)-5-chloro-2-ethylidene-4-fluoropent-3-enyl]isoquinoline (CID 166687668) is 3-[(E,2Z)-5-chloro-2-ethylidene-4-fluoropent-3-enyl]isoquinoline.
What is the SMILES notation for 3-[(E,2Z)-5-chloro-2-ethylidene-4-fluoropent-3-enyl]isoquinoline?
The canonical SMILES for 3-[(E,2Z)-5-chloro-2-ethylidene-4-fluoropent-3-enyl]isoquinoline is C/C=C(\C=C(\F)CCl)Cc1cc2ccccc2cn1.
What is the InChIKey of 3-[(E,2Z)-5-chloro-2-ethylidene-4-fluoropent-3-enyl]isoquinoline?
The InChIKey is CXPJCVVTQICAHE-VIKRKKPCSA-N. The full InChI is InChI=1S/C16H15ClFN/c1-2-12(7-15(18)10-17)8-16-9-13-5-3-4-6-14(13)11-19-16/h2-7,9,11H,8,10H2,1H3/b12-2+,15-7+.
What are the key properties of 3-[(E,2Z)-5-chloro-2-ethylidene-4-fluoropent-3-enyl]isoquinoline?
3-[(E,2Z)-5-chloro-2-ethylidene-4-fluoropent-3-enyl]isoquinoline has a molecular weight of 275.75 g/mol, XLogP of 4.82, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(E,2Z)-5-chloro-2-ethylidene-4-fluoropent-3-enyl]isoquinoline is sourced from PubChem (CID 166687668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).