C19H21ClN6O3 — CID 166688973
methyl (1Z)-N-[2-(4-chloro-3-methylphenyl)ethyl]-N-formyl-2-(7-methyl-6-oxopurin-1-yl)ethanehydrazonate (PubChem CID 166688973) has the molecular formula C19H21ClN6O3 and a molecular weight of 416.87 g/mol. Its IUPAC name is methyl (1Z)-N-[2-(4-chloro-3-methylphenyl)ethyl]-N-formyl-2-(7-methyl-6-oxopurin-1-yl)ethanehydrazonate.
| Compound Name | methyl (1Z)-N-[2-(4-chloro-3-methylphenyl)ethyl]-N-formyl-2-(7-methyl-6-oxopurin-1-yl)ethanehydrazonate |
|---|---|
| PubChem CID | 166688973 |
| Molecular Formula | C19H21ClN6O3 |
| Molecular Weight | 416.87 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | methyl (1Z)-N-[2-(4-chloro-3-methylphenyl)ethyl]-N-formyl-2-(7-methyl-6-oxopurin-1-yl)ethanehydrazonate |
| SMILES | CO/C(Cn1cnc2ncn(C)c2c1=O)=N\N(C=O)CCc1ccc(Cl)c(C)c1 |
| InChI | InChI=1S/C19H21ClN6O3/c1-13-8-14(4-5-15(13)20)6-7-26(12-27)23-16(29-3)9-25-11-22-18-17(19(25)28)24(2)10-21-18/h4-5,8,10-12H,6-7,9H2,1-3H3/b23-16- |
| InChIKey | BWTNXATWVNSUJC-KQWNVCNZSA-N |
| XLogP | 1.75 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.87 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|