C31H43BrN2O9 — CID 166690607
2-[4-[2-[2-[2-[2-[4-[2-[(5-bromo-2-pyridinyl)oxy]ethoxy]butoxy]ethoxy]ethoxy]ethoxy]ethoxy]butyl]isoindole-1,3-dione (PubChem CID 166690607) has the molecular formula C31H43BrN2O9 and a molecular weight of 667.59 g/mol. Its IUPAC name is 2-[4-[2-[2-[2-[2-[4-[2-[(5-bromo-2-pyridinyl)oxy]ethoxy]butoxy]ethoxy]ethoxy]ethoxy]ethoxy]butyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[2-[2-[2-[2-[4-[2-[(5-bromo-2-pyridinyl)oxy]ethoxy]butoxy]ethoxy]ethoxy]ethoxy]ethoxy]butyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 166690607 |
| Molecular Formula | C31H43BrN2O9 |
| Molecular Weight | 667.59 g/mol |
| Exact Mass | 666.22 |
| IUPAC Name | 2-[4-[2-[2-[2-[2-[4-[2-[(5-bromo-2-pyridinyl)oxy]ethoxy]butoxy]ethoxy]ethoxy]ethoxy]ethoxy]butyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCCCOCCOCCOCCOCCOCCCCOCCOc1ccc(Br)cn1 |
| InChI | InChI=1S/C31H43BrN2O9/c32-26-9-10-29(33-25-26)43-24-23-39-14-6-5-13-38-16-18-41-20-22-42-21-19-40-17-15-37-12-4-3-11-34-30(35)27-7-1-2-8-28(27)31(34)36/h1-2,7-10,25H,3-6,11-24H2 |
| InChIKey | NHVHNGULOVJDQI-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 114.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.59 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|