C25H23N7O — CID 166690926
4-(5-cyano-3-pyridinyl)-N-[3-(4-pentyl-1,2,4-triazol-3-yl)phenyl]pyridine-2-carboxamide (PubChem CID 166690926) has the molecular formula C25H23N7O and a molecular weight of 437.51 g/mol. Its IUPAC name is 4-(5-cyano-3-pyridinyl)-N-[3-(4-pentyl-1,2,4-triazol-3-yl)phenyl]pyridine-2-carboxamide.
| Compound Name | 4-(5-cyano-3-pyridinyl)-N-[3-(4-pentyl-1,2,4-triazol-3-yl)phenyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 166690926 |
| Molecular Formula | C25H23N7O |
| Molecular Weight | 437.51 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | 4-(5-cyano-3-pyridinyl)-N-[3-(4-pentyl-1,2,4-triazol-3-yl)phenyl]pyridine-2-carboxamide |
| SMILES | CCCCCn1cnnc1-c1cccc(NC(=O)c2cc(-c3cncc(C#N)c3)ccn2)c1 |
| InChI | InChI=1S/C25H23N7O/c1-2-3-4-10-32-17-29-31-24(32)20-6-5-7-22(12-20)30-25(33)23-13-19(8-9-28-23)21-11-18(14-26)15-27-16-21/h5-9,11-13,15-17H,2-4,10H2,1H3,(H,30,33) |
| InChIKey | KOTFKCUMAZNECT-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 109.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.51 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|