C31H42N4O2 — CID 166691521
4-N-[3-[1-(cyclohexylmethyl)-5-nitroindol-3-yl]-3-(3-methylphenyl)propyl]cyclohexane-1,4-diamine (PubChem CID 166691521) has the molecular formula C31H42N4O2 and a molecular weight of 502.70 g/mol. Its IUPAC name is 4-N-[3-[1-(cyclohexylmethyl)-5-nitroindol-3-yl]-3-(3-methylphenyl)propyl]cyclohexane-1,4-diamine.
| Compound Name | 4-N-[3-[1-(cyclohexylmethyl)-5-nitroindol-3-yl]-3-(3-methylphenyl)propyl]cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 166691521 |
| Molecular Formula | C31H42N4O2 |
| Molecular Weight | 502.70 g/mol |
| Exact Mass | 502.33 |
| IUPAC Name | 4-N-[3-[1-(cyclohexylmethyl)-5-nitroindol-3-yl]-3-(3-methylphenyl)propyl]cyclohexane-1,4-diamine |
| SMILES | Cc1cccc(C(CCNC2CCC(N)CC2)c2cn(CC3CCCCC3)c3ccc([N+](=O)[O-])cc23)c1 |
| InChI | InChI=1S/C31H42N4O2/c1-22-6-5-9-24(18-22)28(16-17-33-26-12-10-25(32)11-13-26)30-21-34(20-23-7-3-2-4-8-23)31-15-14-27(35(36)37)19-29(30)31/h5-6,9,14-15,18-19,21,23,25-26,28,33H,2-4,7-8,10-13,16-17,20,32H2,1H3 |
| InChIKey | CYIMEBCHCLGKQK-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 86.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.70 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|