C31H44N4O2 — CID 159488727
4-N-[3-(1-cyclohexyl-5-nitroindol-3-yl)-3-(3-methylphenyl)propyl]cyclohexane-1,4-diamine;methane (PubChem CID 159488727) has the molecular formula C31H44N4O2 and a molecular weight of 504.72 g/mol. Its IUPAC name is 4-N-[3-(1-cyclohexyl-5-nitroindol-3-yl)-3-(3-methylphenyl)propyl]cyclohexane-1,4-diamine;methane.
| Compound Name | 4-N-[3-(1-cyclohexyl-5-nitroindol-3-yl)-3-(3-methylphenyl)propyl]cyclohexane-1,4-diamine;methane |
|---|---|
| PubChem CID | 159488727 |
| Molecular Formula | C31H44N4O2 |
| Molecular Weight | 504.72 g/mol |
| Exact Mass | 504.35 |
| IUPAC Name | 4-N-[3-(1-cyclohexyl-5-nitroindol-3-yl)-3-(3-methylphenyl)propyl]cyclohexane-1,4-diamine;methane |
| SMILES | C.Cc1cccc(C(CCNC2CCC(N)CC2)c2cn(C3CCCCC3)c3ccc([N+](=O)[O-])cc23)c1 |
| InChI | InChI=1S/C30H40N4O2.CH4/c1-21-6-5-7-22(18-21)27(16-17-32-24-12-10-23(31)11-13-24)29-20-33(25-8-3-2-4-9-25)30-15-14-26(34(35)36)19-28(29)30;/h5-7,14-15,18-20,23-25,27,32H,2-4,8-13,16-17,31H2,1H3;1H4 |
| InChIKey | LXXKDAQABPCDEV-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 86.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.72 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|