C28H36N4 — CID 158039799
N'-[3-(1-cyclohexyl-5-isocyanoindol-3-yl)-3-(3-methylphenyl)propyl]propane-1,3-diamine (PubChem CID 158039799) has the molecular formula C28H36N4 and a molecular weight of 428.62 g/mol. Its IUPAC name is N'-[3-(1-cyclohexyl-5-isocyanoindol-3-yl)-3-(3-methylphenyl)propyl]propane-1,3-diamine.
| Compound Name | N'-[3-(1-cyclohexyl-5-isocyanoindol-3-yl)-3-(3-methylphenyl)propyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 158039799 |
| Molecular Formula | C28H36N4 |
| Molecular Weight | 428.62 g/mol |
| Exact Mass | 428.29 |
| IUPAC Name | N'-[3-(1-cyclohexyl-5-isocyanoindol-3-yl)-3-(3-methylphenyl)propyl]propane-1,3-diamine |
| SMILES | [C-]#[N+]c1ccc2c(c1)c(C(CCNCCCN)c1cccc(C)c1)cn2C1CCCCC1 |
| InChI | InChI=1S/C28H36N4/c1-21-8-6-9-22(18-21)25(14-17-31-16-7-15-29)27-20-32(24-10-4-3-5-11-24)28-13-12-23(30-2)19-26(27)28/h6,8-9,12-13,18-20,24-25,31H,3-5,7,10-11,14-17,29H2,1H3 |
| InChIKey | VVAMNZJYWBFRFM-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 47.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.62 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|