C27H38N4 — CID 142579326
3-N-[3-(1-cyclohexylindol-3-yl)-3-(3-methylphenyl)propyl]propane-1,2,3-triamine (PubChem CID 142579326) has the molecular formula C27H38N4 and a molecular weight of 418.63 g/mol. Its IUPAC name is 3-N-[3-(1-cyclohexylindol-3-yl)-3-(3-methylphenyl)propyl]propane-1,2,3-triamine.
| Compound Name | 3-N-[3-(1-cyclohexylindol-3-yl)-3-(3-methylphenyl)propyl]propane-1,2,3-triamine |
|---|---|
| PubChem CID | 142579326 |
| Molecular Formula | C27H38N4 |
| Molecular Weight | 418.63 g/mol |
| Exact Mass | 418.31 |
| IUPAC Name | 3-N-[3-(1-cyclohexylindol-3-yl)-3-(3-methylphenyl)propyl]propane-1,2,3-triamine |
| SMILES | Cc1cccc(C(CCNCC(N)CN)c2cn(C3CCCCC3)c3ccccc23)c1 |
| InChI | InChI=1S/C27H38N4/c1-20-8-7-9-21(16-20)24(14-15-30-18-22(29)17-28)26-19-31(23-10-3-2-4-11-23)27-13-6-5-12-25(26)27/h5-9,12-13,16,19,22-24,30H,2-4,10-11,14-15,17-18,28-29H2,1H3 |
| InChIKey | NYELBYXRFFNMTC-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 69.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.63 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|