C27H33F3N2O — CID 142579537
3-(1-cyclohexylindol-3-yl)-N-propyl-3-[3-(trifluoromethoxy)phenyl]propan-1-amine (PubChem CID 142579537) has the molecular formula C27H33F3N2O and a molecular weight of 458.57 g/mol. Its IUPAC name is 3-(1-cyclohexylindol-3-yl)-N-propyl-3-[3-(trifluoromethoxy)phenyl]propan-1-amine.
| Compound Name | 3-(1-cyclohexylindol-3-yl)-N-propyl-3-[3-(trifluoromethoxy)phenyl]propan-1-amine |
|---|---|
| PubChem CID | 142579537 |
| Molecular Formula | C27H33F3N2O |
| Molecular Weight | 458.57 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | 3-(1-cyclohexylindol-3-yl)-N-propyl-3-[3-(trifluoromethoxy)phenyl]propan-1-amine |
| SMILES | CCCNCCC(c1cccc(OC(F)(F)F)c1)c1cn(C2CCCCC2)c2ccccc12 |
| InChI | InChI=1S/C27H33F3N2O/c1-2-16-31-17-15-23(20-9-8-12-22(18-20)33-27(28,29)30)25-19-32(21-10-4-3-5-11-21)26-14-7-6-13-24(25)26/h6-9,12-14,18-19,21,23,31H,2-5,10-11,15-17H2,1H3 |
| InChIKey | PVZLUAOBDXRAJP-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 26.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.57 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|