C9H13NO2 — CID 166692396
1,3-bis(prop-2-ynoxy)propan-2-amine (PubChem CID 166692396) has the molecular formula C9H13NO2 and a molecular weight of 167.21 g/mol. Its IUPAC name is 1,3-bis(prop-2-ynoxy)propan-2-amine.
| Compound Name | 1,3-bis(prop-2-ynoxy)propan-2-amine |
|---|---|
| PubChem CID | 166692396 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | 1,3-bis(prop-2-ynoxy)propan-2-amine |
| SMILES | C#CCOCC(N)COCC#C |
| InChI | InChI=1S/C9H13NO2/c1-3-5-11-7-9(10)8-12-6-4-2/h1-2,9H,5-8,10H2 |
| InChIKey | DVEILOXEDXFISB-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|