About S-methyl 6-[[4-(2-methylpropoxymethyl)benzoyl]amino]hexanethioate
S-methyl 6-[[4-(2-methylpropoxymethyl)benzoyl]amino]hexanethioate (PubChem CID 166694909) has the molecular formula C19H29NO3S
and a molecular weight of 351.51 g/mol. Its IUPAC name is S-methyl 6-[[4-(2-methylpropoxymethyl)benzoyl]amino]hexanethioate.
Molecular Properties
| Compound Name | S-methyl 6-[[4-(2-methylpropoxymethyl)benzoyl]amino]hexanethioate |
| PubChem CID | 166694909 |
| Molecular Formula | C19H29NO3S |
| Molecular Weight | 351.51 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | S-methyl 6-[[4-(2-methylpropoxymethyl)benzoyl]amino]hexanethioate |
| SMILES | CSC(=O)CCCCCNC(=O)c1ccc(COCC(C)C)cc1 |
| InChI | InChI=1S/C19H29NO3S/c1-15(2)13-23-14-16-8-10-17(11-9-16)19(22)20-12-6-4-5-7-18(21)24-3/h8-11,15H,4-7,12-14H2,1-3H3,(H,20,22) |
| InChIKey | XYBGWTABXFOFGD-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.51 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-methyl 6-[[4-(2-methylpropoxymethyl)benzoyl]amino]hexanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-methyl 6-[[4-(2-methylpropoxymethyl)benzoyl]amino]hexanethioate?
The IUPAC name of S-methyl 6-[[4-(2-methylpropoxymethyl)benzoyl]amino]hexanethioate (CID 166694909) is S-methyl 6-[[4-(2-methylpropoxymethyl)benzoyl]amino]hexanethioate.
What is the SMILES notation for S-methyl 6-[[4-(2-methylpropoxymethyl)benzoyl]amino]hexanethioate?
The canonical SMILES for S-methyl 6-[[4-(2-methylpropoxymethyl)benzoyl]amino]hexanethioate is CSC(=O)CCCCCNC(=O)c1ccc(COCC(C)C)cc1.
What is the InChIKey of S-methyl 6-[[4-(2-methylpropoxymethyl)benzoyl]amino]hexanethioate?
The InChIKey is XYBGWTABXFOFGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H29NO3S/c1-15(2)13-23-14-16-8-10-17(11-9-16)19(22)20-12-6-4-5-7-18(21)24-3/h8-11,15H,4-7,12-14H2,1-3H3,(H,20,22).
What are the key properties of S-methyl 6-[[4-(2-methylpropoxymethyl)benzoyl]amino]hexanethioate?
S-methyl 6-[[4-(2-methylpropoxymethyl)benzoyl]amino]hexanethioate has a molecular weight of 351.51 g/mol, XLogP of 4.04, 11 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-methyl 6-[[4-(2-methylpropoxymethyl)benzoyl]amino]hexanethioate is sourced from PubChem (CID 166694909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).