C54H42N2 — CID 166695978
2-[(E,1E)-3-[3-(3,5-diphenylphenyl)-10-(5-pyridin-2-ylcyclohexa-1,3-dien-1-yl)anthracen-9-yl]-1-ethylidenebut-2-enyl]pyridine (PubChem CID 166695978) has the molecular formula C54H42N2 and a molecular weight of 718.94 g/mol. Its IUPAC name is 2-[(E,1E)-3-[3-(3,5-diphenylphenyl)-10-(5-pyridin-2-ylcyclohexa-1,3-dien-1-yl)anthracen-9-yl]-1-ethylidenebut-2-enyl]pyridine.
| Compound Name | 2-[(E,1E)-3-[3-(3,5-diphenylphenyl)-10-(5-pyridin-2-ylcyclohexa-1,3-dien-1-yl)anthracen-9-yl]-1-ethylidenebut-2-enyl]pyridine |
|---|---|
| PubChem CID | 166695978 |
| Molecular Formula | C54H42N2 |
| Molecular Weight | 718.94 g/mol |
| Exact Mass | 718.33 |
| IUPAC Name | 2-[(E,1E)-3-[3-(3,5-diphenylphenyl)-10-(5-pyridin-2-ylcyclohexa-1,3-dien-1-yl)anthracen-9-yl]-1-ethylidenebut-2-enyl]pyridine |
| SMILES | C/C=C(\C=C(/C)c1c2ccccc2c(C2=CC=CC(c3ccccn3)C2)c2cc(-c3cc(-c4ccccc4)cc(-c4ccccc4)c3)ccc12)c1ccccn1 |
| InChI | InChI=1S/C54H42N2/c1-3-38(51-25-12-14-29-55-51)31-37(2)53-47-23-10-11-24-48(47)54(43-22-16-21-42(32-43)52-26-13-15-30-56-52)50-36-41(27-28-49(50)53)46-34-44(39-17-6-4-7-18-39)33-45(35-46)40-19-8-5-9-20-40/h3-31,33-36,42H,32H2,1-2H3/b37-31+,38-3+ |
| InChIKey | QBZCSJOXOGKPCE-VYWMDFAHSA-N |
| XLogP | 14.42 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.94 |
| LogP ≤ 5 | 14.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|