C21H24N6O — CID 166697373
2-(4-aminophenyl)-N-[[4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenyl]methyl]pentanamide (PubChem CID 166697373) has the molecular formula C21H24N6O and a molecular weight of 376.46 g/mol. Its IUPAC name is 2-(4-aminophenyl)-N-[[4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenyl]methyl]pentanamide.
| Compound Name | 2-(4-aminophenyl)-N-[[4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenyl]methyl]pentanamide |
|---|---|
| PubChem CID | 166697373 |
| Molecular Formula | C21H24N6O |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 2-(4-aminophenyl)-N-[[4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenyl]methyl]pentanamide |
| SMILES | CCCC(C(=O)NCc1ccc(-c2nnc(C)nn2)cc1)c1ccc(N)cc1 |
| InChI | InChI=1S/C21H24N6O/c1-3-4-19(16-9-11-18(22)12-10-16)21(28)23-13-15-5-7-17(8-6-15)20-26-24-14(2)25-27-20/h5-12,19H,3-4,13,22H2,1-2H3,(H,23,28) |
| InChIKey | CRHQKGPLTOIIRI-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 106.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|