C31H37N3O5 — CID 166697569
(10R,15S)-4-ethoxy-10-(3-hydroxyphenyl)-15-methyl-13-[3-(oxepan-4-yl)propyl]-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene-12,14-dione (PubChem CID 166697569) has the molecular formula C31H37N3O5 and a molecular weight of 531.65 g/mol. Its IUPAC name is (10R,15S)-4-ethoxy-10-(3-hydroxyphenyl)-15-methyl-13-[3-(oxepan-4-yl)propyl]-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene-12,14-dione.
| Compound Name | (10R,15S)-4-ethoxy-10-(3-hydroxyphenyl)-15-methyl-13-[3-(oxepan-4-yl)propyl]-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene-12,14-dione |
|---|---|
| PubChem CID | 166697569 |
| Molecular Formula | C31H37N3O5 |
| Molecular Weight | 531.65 g/mol |
| Exact Mass | 531.27 |
| IUPAC Name | (10R,15S)-4-ethoxy-10-(3-hydroxyphenyl)-15-methyl-13-[3-(oxepan-4-yl)propyl]-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene-12,14-dione |
| SMILES | CCOc1ccc2[nH]c3c(c2c1)C[C@@]1(C)C(=O)N(CCCC2CCCOCC2)C(=O)N1[C@@H]3c1cccc(O)c1 |
| InChI | InChI=1S/C31H37N3O5/c1-3-39-23-11-12-26-24(18-23)25-19-31(2)29(36)33(14-5-7-20-8-6-15-38-16-13-20)30(37)34(31)28(27(25)32-26)21-9-4-10-22(35)17-21/h4,9-12,17-18,20,28,32,35H,3,5-8,13-16,19H2,1-2H3/t20?,28-,31+/m1/s1 |
| InChIKey | BHNOXTMLHRKKHG-KORWYMCFSA-N |
| XLogP | 5.54 |
| TPSA | 95.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.65 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|