C23H24F3NO4 — CID 166701165
3-[3-[4-[2-(trifluoromethoxy)phenyl]piperidin-1-yl]propoxy]phthalaldehyde (PubChem CID 166701165) has the molecular formula C23H24F3NO4 and a molecular weight of 435.44 g/mol. Its IUPAC name is 3-[3-[4-[2-(trifluoromethoxy)phenyl]piperidin-1-yl]propoxy]phthalaldehyde.
| Compound Name | 3-[3-[4-[2-(trifluoromethoxy)phenyl]piperidin-1-yl]propoxy]phthalaldehyde |
|---|---|
| PubChem CID | 166701165 |
| Molecular Formula | C23H24F3NO4 |
| Molecular Weight | 435.44 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 3-[3-[4-[2-(trifluoromethoxy)phenyl]piperidin-1-yl]propoxy]phthalaldehyde |
| SMILES | O=Cc1cccc(OCCCN2CCC(c3ccccc3OC(F)(F)F)CC2)c1C=O |
| InChI | InChI=1S/C23H24F3NO4/c24-23(25,26)31-22-7-2-1-6-19(22)17-9-12-27(13-10-17)11-4-14-30-21-8-3-5-18(15-28)20(21)16-29/h1-3,5-8,15-17H,4,9-14H2 |
| InChIKey | IWARDPGDGMTYRQ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.44 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|