C23H28F2N2O — CID 141092517
2,2-difluoro-N-[3-[4-(2-methylphenyl)piperidin-1-yl]propyl]-2-phenylacetamide (PubChem CID 141092517) has the molecular formula C23H28F2N2O and a molecular weight of 386.49 g/mol. Its IUPAC name is 2,2-difluoro-N-[3-[4-(2-methylphenyl)piperidin-1-yl]propyl]-2-phenylacetamide.
| Compound Name | 2,2-difluoro-N-[3-[4-(2-methylphenyl)piperidin-1-yl]propyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 141092517 |
| Molecular Formula | C23H28F2N2O |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | 2,2-difluoro-N-[3-[4-(2-methylphenyl)piperidin-1-yl]propyl]-2-phenylacetamide |
| SMILES | Cc1ccccc1C1CCN(CCCNC(=O)C(F)(F)c2ccccc2)CC1 |
| InChI | InChI=1S/C23H28F2N2O/c1-18-8-5-6-11-21(18)19-12-16-27(17-13-19)15-7-14-26-22(28)23(24,25)20-9-3-2-4-10-20/h2-6,8-11,19H,7,12-17H2,1H3,(H,26,28) |
| InChIKey | BMHUXEVCTRNEQK-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|