C27H33F2N3O2 — CID 91493148
2-(3,4-difluorophenyl)-2-(2-oxopyrrolidin-1-yl)-N-[3-(4-phenylpiperidin-1-yl)propyl]propanamide (PubChem CID 91493148) has the molecular formula C27H33F2N3O2 and a molecular weight of 469.58 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-2-(2-oxopyrrolidin-1-yl)-N-[3-(4-phenylpiperidin-1-yl)propyl]propanamide.
| Compound Name | 2-(3,4-difluorophenyl)-2-(2-oxopyrrolidin-1-yl)-N-[3-(4-phenylpiperidin-1-yl)propyl]propanamide |
|---|---|
| PubChem CID | 91493148 |
| Molecular Formula | C27H33F2N3O2 |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.25 |
| IUPAC Name | 2-(3,4-difluorophenyl)-2-(2-oxopyrrolidin-1-yl)-N-[3-(4-phenylpiperidin-1-yl)propyl]propanamide |
| SMILES | CC(C(=O)NCCCN1CCC(c2ccccc2)CC1)(c1ccc(F)c(F)c1)N1CCCC1=O |
| InChI | InChI=1S/C27H33F2N3O2/c1-27(32-16-5-9-25(32)33,22-10-11-23(28)24(29)19-22)26(34)30-14-6-15-31-17-12-21(13-18-31)20-7-3-2-4-8-20/h2-4,7-8,10-11,19,21H,5-6,9,12-18H2,1H3,(H,30,34) |
| InChIKey | ZWXXPHXZRDQDLR-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|