C25H31N — CID 166703345
N-[4-(2,2,4,4-tetramethylpentyl)phenyl]naphthalen-1-amine (PubChem CID 166703345) has the molecular formula C25H31N and a molecular weight of 345.53 g/mol. Its IUPAC name is N-[4-(2,2,4,4-tetramethylpentyl)phenyl]naphthalen-1-amine.
| Compound Name | N-[4-(2,2,4,4-tetramethylpentyl)phenyl]naphthalen-1-amine |
|---|---|
| PubChem CID | 166703345 |
| Molecular Formula | C25H31N |
| Molecular Weight | 345.53 g/mol |
| Exact Mass | 345.25 |
| IUPAC Name | N-[4-(2,2,4,4-tetramethylpentyl)phenyl]naphthalen-1-amine |
| SMILES | CC(C)(C)CC(C)(C)Cc1ccc(Nc2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C25H31N/c1-24(2,3)18-25(4,5)17-19-13-15-21(16-14-19)26-23-12-8-10-20-9-6-7-11-22(20)23/h6-16,26H,17-18H2,1-5H3 |
| InChIKey | MZYXBHUIHCFLHB-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.53 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |