C10H20N4O3 — CID 166704062
N'-methyl-2-[[2-(propan-2-ylamino)acetyl]amino]butanediamide (PubChem CID 166704062) has the molecular formula C10H20N4O3 and a molecular weight of 244.29 g/mol. Its IUPAC name is N'-methyl-2-[[2-(propan-2-ylamino)acetyl]amino]butanediamide.
| Compound Name | N'-methyl-2-[[2-(propan-2-ylamino)acetyl]amino]butanediamide |
|---|---|
| PubChem CID | 166704062 |
| Molecular Formula | C10H20N4O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | N'-methyl-2-[[2-(propan-2-ylamino)acetyl]amino]butanediamide |
| SMILES | CNC(=O)CC(NC(=O)CNC(C)C)C(N)=O |
| InChI | InChI=1S/C10H20N4O3/c1-6(2)13-5-9(16)14-7(10(11)17)4-8(15)12-3/h6-7,13H,4-5H2,1-3H3,(H2,11,17)(H,12,15)(H,14,16) |
| InChIKey | XLCVWUJJQAYOAF-UHFFFAOYSA-N |
| XLogP | -1.91 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |