C26H31FN4O3 — CID 166705915
3-[(2-amino-4,4-dimethyl-6-oxo-5H-pyrimidin-1-yl)methyl]-5-fluoro-N-[(3S,4S)-2,2,3-trimethyl-3,4-dihydrochromen-4-yl]benzamide (PubChem CID 166705915) has the molecular formula C26H31FN4O3 and a molecular weight of 466.56 g/mol. Its IUPAC name is 3-[(2-amino-4,4-dimethyl-6-oxo-5H-pyrimidin-1-yl)methyl]-5-fluoro-N-[(3S,4S)-2,2,3-trimethyl-3,4-dihydrochromen-4-yl]benzamide.
| Compound Name | 3-[(2-amino-4,4-dimethyl-6-oxo-5H-pyrimidin-1-yl)methyl]-5-fluoro-N-[(3S,4S)-2,2,3-trimethyl-3,4-dihydrochromen-4-yl]benzamide |
|---|---|
| PubChem CID | 166705915 |
| Molecular Formula | C26H31FN4O3 |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | 3-[(2-amino-4,4-dimethyl-6-oxo-5H-pyrimidin-1-yl)methyl]-5-fluoro-N-[(3S,4S)-2,2,3-trimethyl-3,4-dihydrochromen-4-yl]benzamide |
| SMILES | C[C@H]1[C@H](NC(=O)c2cc(F)cc(CN3C(=O)CC(C)(C)N=C3N)c2)c2ccccc2OC1(C)C |
| InChI | InChI=1S/C26H31FN4O3/c1-15-22(19-8-6-7-9-20(19)34-26(15,4)5)29-23(33)17-10-16(11-18(27)12-17)14-31-21(32)13-25(2,3)30-24(31)28/h6-12,15,22H,13-14H2,1-5H3,(H2,28,30)(H,29,33)/t15-,22-/m0/s1 |
| InChIKey | ZAGCPSZFIBQVKS-NYHFZMIOSA-N |
| XLogP | 3.93 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |