C10H16N2O — CID 166707318
(E)-4-ethyl-2,3-bis(methylimino)hex-4-enal (PubChem CID 166707318) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is (E)-4-ethyl-2,3-bis(methylimino)hex-4-enal.
| Compound Name | (E)-4-ethyl-2,3-bis(methylimino)hex-4-enal |
|---|---|
| PubChem CID | 166707318 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | (E)-4-ethyl-2,3-bis(methylimino)hex-4-enal |
| SMILES | C/C=C(CC)/C(=N\C)C(/C=O)=N/C |
| InChI | InChI=1S/C10H16N2O/c1-5-8(6-2)10(12-4)9(7-13)11-3/h5,7H,6H2,1-4H3/b8-5+,11-9+,12-10+ |
| InChIKey | PNNZRCNWLMSSDX-YBHDQPKJSA-N |
| XLogP | 1.68 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|