C17H18N4O — CID 166710327
(5-benzyl-12-methyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-3,7,9,11-tetraen-4-yl)methanol (PubChem CID 166710327) has the molecular formula C17H18N4O and a molecular weight of 294.36 g/mol. Its IUPAC name is (5-benzyl-12-methyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-3,7,9,11-tetraen-4-yl)methanol.
| Compound Name | (5-benzyl-12-methyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-3,7,9,11-tetraen-4-yl)methanol |
|---|---|
| PubChem CID | 166710327 |
| Molecular Formula | C17H18N4O |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | (5-benzyl-12-methyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-3,7,9,11-tetraen-4-yl)methanol |
| SMILES | Cc1nnc2n1C1C=C(CO)N(Cc3ccccc3)C1C=C2 |
| InChI | InChI=1S/C17H18N4O/c1-12-18-19-17-8-7-15-16(21(12)17)9-14(11-22)20(15)10-13-5-3-2-4-6-13/h2-9,15-16,22H,10-11H2,1H3 |
| InChIKey | JHNQRUMNXQEJMI-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |