C18H21N3O2S — CID 16671160
2-[[(2S)-1-(cyclobutanecarbonyl)pyrrolidin-2-yl]methyl]-6-thiophen-2-ylpyridazin-3-one (PubChem CID 16671160) has the molecular formula C18H21N3O2S and a molecular weight of 343.45 g/mol. Its IUPAC name is 2-[[(2S)-1-(cyclobutanecarbonyl)pyrrolidin-2-yl]methyl]-6-thiophen-2-ylpyridazin-3-one.
| Compound Name | 2-[[(2S)-1-(cyclobutanecarbonyl)pyrrolidin-2-yl]methyl]-6-thiophen-2-ylpyridazin-3-one |
|---|---|
| PubChem CID | 16671160 |
| Molecular Formula | C18H21N3O2S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 2-[[(2S)-1-(cyclobutanecarbonyl)pyrrolidin-2-yl]methyl]-6-thiophen-2-ylpyridazin-3-one |
| SMILES | O=C(C1CCC1)N1CCC[C@H]1Cn1nc(-c2cccs2)ccc1=O |
| InChI | InChI=1S/C18H21N3O2S/c22-17-9-8-15(16-7-3-11-24-16)19-21(17)12-14-6-2-10-20(14)18(23)13-4-1-5-13/h3,7-9,11,13-14H,1-2,4-6,10,12H2/t14-/m0/s1 |
| InChIKey | YHTYRPDXGBZIIQ-AWEZNQCLSA-N |
| XLogP | 2.76 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |