C19H19FN6O — CID 166713817
9-[(2-fluoro-4-methylphenyl)methyl]-2-methoxy-7-methyl-8-pyridazin-3-yl-8H-purine (PubChem CID 166713817) has the molecular formula C19H19FN6O and a molecular weight of 366.40 g/mol. Its IUPAC name is 9-[(2-fluoro-4-methylphenyl)methyl]-2-methoxy-7-methyl-8-pyridazin-3-yl-8H-purine.
| Compound Name | 9-[(2-fluoro-4-methylphenyl)methyl]-2-methoxy-7-methyl-8-pyridazin-3-yl-8H-purine |
|---|---|
| PubChem CID | 166713817 |
| Molecular Formula | C19H19FN6O |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 9-[(2-fluoro-4-methylphenyl)methyl]-2-methoxy-7-methyl-8-pyridazin-3-yl-8H-purine |
| SMILES | COc1ncc2c(n1)N(Cc1ccc(C)cc1F)C(c1cccnn1)N2C |
| InChI | InChI=1S/C19H19FN6O/c1-12-6-7-13(14(20)9-12)11-26-17-16(10-21-19(23-17)27-3)25(2)18(26)15-5-4-8-22-24-15/h4-10,18H,11H2,1-3H3 |
| InChIKey | KXEQNEZJJBGQBH-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 67.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |