C21H21BrFN5O2S — CID 166713796
8-(5-bromo-3-pyridinyl)-9-[(2-fluoro-4-methylsulfanyloxyphenyl)methyl]-2-methoxy-6,7-dimethyl-8H-purine (PubChem CID 166713796) has the molecular formula C21H21BrFN5O2S and a molecular weight of 506.40 g/mol. Its IUPAC name is 8-(5-bromo-3-pyridinyl)-9-[(2-fluoro-4-methylsulfanyloxyphenyl)methyl]-2-methoxy-6,7-dimethyl-8H-purine.
| Compound Name | 8-(5-bromo-3-pyridinyl)-9-[(2-fluoro-4-methylsulfanyloxyphenyl)methyl]-2-methoxy-6,7-dimethyl-8H-purine |
|---|---|
| PubChem CID | 166713796 |
| Molecular Formula | C21H21BrFN5O2S |
| Molecular Weight | 506.40 g/mol |
| Exact Mass | 505.06 |
| IUPAC Name | 8-(5-bromo-3-pyridinyl)-9-[(2-fluoro-4-methylsulfanyloxyphenyl)methyl]-2-methoxy-6,7-dimethyl-8H-purine |
| SMILES | COc1nc(C)c2c(n1)N(Cc1ccc(OSC)cc1F)C(c1cncc(Br)c1)N2C |
| InChI | InChI=1S/C21H21BrFN5O2S/c1-12-18-19(26-21(25-12)29-3)28(11-13-5-6-16(30-31-4)8-17(13)23)20(27(18)2)14-7-15(22)10-24-9-14/h5-10,20H,11H2,1-4H3 |
| InChIKey | FETGZDLYWJRRSX-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 63.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.40 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|