C20H17BrFN5O4S — CID 138701058
[4-[[8-(5-bromo-3-pyridinyl)-2-methoxy-6-methylpurin-9-yl]methyl]-3-fluorophenyl] methanesulfonate (PubChem CID 138701058) has the molecular formula C20H17BrFN5O4S and a molecular weight of 522.36 g/mol. Its IUPAC name is [4-[[8-(5-bromo-3-pyridinyl)-2-methoxy-6-methylpurin-9-yl]methyl]-3-fluorophenyl] methanesulfonate.
| Compound Name | [4-[[8-(5-bromo-3-pyridinyl)-2-methoxy-6-methylpurin-9-yl]methyl]-3-fluorophenyl] methanesulfonate |
|---|---|
| PubChem CID | 138701058 |
| Molecular Formula | C20H17BrFN5O4S |
| Molecular Weight | 522.36 g/mol |
| Exact Mass | 521.02 |
| IUPAC Name | [4-[[8-(5-bromo-3-pyridinyl)-2-methoxy-6-methylpurin-9-yl]methyl]-3-fluorophenyl] methanesulfonate |
| SMILES | COc1nc(C)c2nc(-c3cncc(Br)c3)n(Cc3ccc(OS(C)(=O)=O)cc3F)c2n1 |
| InChI | InChI=1S/C20H17BrFN5O4S/c1-11-17-19(26-20(24-11)30-2)27(18(25-17)13-6-14(21)9-23-8-13)10-12-4-5-15(7-16(12)22)31-32(3,28)29/h4-9H,10H2,1-3H3 |
| InChIKey | WTUHSSGONPKDCA-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 109.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.36 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|