C16H30INO2 — CID 166714269
6-[tert-butyl(methyl)amino]-2-iodo-2,8-dimethylnonane-3,7-dione (PubChem CID 166714269) has the molecular formula C16H30INO2 and a molecular weight of 395.33 g/mol. Its IUPAC name is 6-[tert-butyl(methyl)amino]-2-iodo-2,8-dimethylnonane-3,7-dione.
| Compound Name | 6-[tert-butyl(methyl)amino]-2-iodo-2,8-dimethylnonane-3,7-dione |
|---|---|
| PubChem CID | 166714269 |
| Molecular Formula | C16H30INO2 |
| Molecular Weight | 395.33 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 6-[tert-butyl(methyl)amino]-2-iodo-2,8-dimethylnonane-3,7-dione |
| SMILES | CC(C)C(=O)C(CCC(=O)C(C)(C)I)N(C)C(C)(C)C |
| InChI | InChI=1S/C16H30INO2/c1-11(2)14(20)12(18(8)15(3,4)5)9-10-13(19)16(6,7)17/h11-12H,9-10H2,1-8H3 |
| InChIKey | OOSMLRFGMWFMOX-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.33 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|