C30H18BrIS — CID 166714618
7-bromo-3-(4-iodophenyl)-1,4-diphenyldibenzothiophene (PubChem CID 166714618) has the molecular formula C30H18BrIS and a molecular weight of 617.35 g/mol. Its IUPAC name is 7-bromo-3-(4-iodophenyl)-1,4-diphenyldibenzothiophene.
| Compound Name | 7-bromo-3-(4-iodophenyl)-1,4-diphenyldibenzothiophene |
|---|---|
| PubChem CID | 166714618 |
| Molecular Formula | C30H18BrIS |
| Molecular Weight | 617.35 g/mol |
| Exact Mass | 615.94 |
| IUPAC Name | 7-bromo-3-(4-iodophenyl)-1,4-diphenyldibenzothiophene |
| SMILES | Brc1ccc2c(c1)sc1c(-c3ccccc3)c(-c3ccc(I)cc3)cc(-c3ccccc3)c12 |
| InChI | InChI=1S/C30H18BrIS/c31-22-13-16-24-27(17-22)33-30-28(21-9-5-2-6-10-21)25(20-11-14-23(32)15-12-20)18-26(29(24)30)19-7-3-1-4-8-19/h1-18H |
| InChIKey | HNCZJAMDVGZVRD-UHFFFAOYSA-N |
| XLogP | 10.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.35 |
| LogP ≤ 5 | 10.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|