C41H30N4 — CID 166715752
4-[3-(2-cyclohexa-1,3-dien-1-yl-6-phenylpyrimidin-4-yl)phenyl]-2-methyl-9-phenyl-1,10-phenanthroline (PubChem CID 166715752) has the molecular formula C41H30N4 and a molecular weight of 578.72 g/mol. Its IUPAC name is 4-[3-(2-cyclohexa-1,3-dien-1-yl-6-phenylpyrimidin-4-yl)phenyl]-2-methyl-9-phenyl-1,10-phenanthroline.
| Compound Name | 4-[3-(2-cyclohexa-1,3-dien-1-yl-6-phenylpyrimidin-4-yl)phenyl]-2-methyl-9-phenyl-1,10-phenanthroline |
|---|---|
| PubChem CID | 166715752 |
| Molecular Formula | C41H30N4 |
| Molecular Weight | 578.72 g/mol |
| Exact Mass | 578.25 |
| IUPAC Name | 4-[3-(2-cyclohexa-1,3-dien-1-yl-6-phenylpyrimidin-4-yl)phenyl]-2-methyl-9-phenyl-1,10-phenanthroline |
| SMILES | Cc1cc(-c2cccc(-c3cc(-c4ccccc4)nc(C4=CC=CCC4)n3)c2)c2ccc3ccc(-c4ccccc4)nc3c2n1 |
| InChI | InChI=1S/C41H30N4/c1-27-24-35(34-22-20-30-21-23-36(28-12-5-2-6-13-28)43-39(30)40(34)42-27)32-18-11-19-33(25-32)38-26-37(29-14-7-3-8-15-29)44-41(45-38)31-16-9-4-10-17-31/h2-9,11-16,18-26H,10,17H2,1H3 |
| InChIKey | CDNYPXIPCXFEJJ-UHFFFAOYSA-N |
| XLogP | 10.28 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.72 |
| LogP ≤ 5 | 10.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|