C25H30N4O4S — CID 166716850
6-[(3R)-3-(dihydroxymethyl)-3-methylpiperidin-1-yl]-N-[5-methyl-6-(2-methylphenyl)-2-pyridinyl]pyridine-2-sulfonamide (PubChem CID 166716850) has the molecular formula C25H30N4O4S and a molecular weight of 482.61 g/mol. Its IUPAC name is 6-[(3R)-3-(dihydroxymethyl)-3-methylpiperidin-1-yl]-N-[5-methyl-6-(2-methylphenyl)-2-pyridinyl]pyridine-2-sulfonamide.
| Compound Name | 6-[(3R)-3-(dihydroxymethyl)-3-methylpiperidin-1-yl]-N-[5-methyl-6-(2-methylphenyl)-2-pyridinyl]pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 166716850 |
| Molecular Formula | C25H30N4O4S |
| Molecular Weight | 482.61 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | 6-[(3R)-3-(dihydroxymethyl)-3-methylpiperidin-1-yl]-N-[5-methyl-6-(2-methylphenyl)-2-pyridinyl]pyridine-2-sulfonamide |
| SMILES | Cc1ccccc1-c1nc(NS(=O)(=O)c2cccc(N3CCC[C@@](C)(C(O)O)C3)n2)ccc1C |
| InChI | InChI=1S/C25H30N4O4S/c1-17-8-4-5-9-19(17)23-18(2)12-13-20(26-23)28-34(32,33)22-11-6-10-21(27-22)29-15-7-14-25(3,16-29)24(30)31/h4-6,8-13,24,30-31H,7,14-16H2,1-3H3,(H,26,28)/t25-/m1/s1 |
| InChIKey | KLWJQLDSCIOEKY-RUZDIDTESA-N |
| XLogP | 3.48 |
| TPSA | 115.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.61 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|