C8H17NO — CID 166717132
4-ethyl-2-propan-2-yl-1,2-oxazolidine (PubChem CID 166717132) has the molecular formula C8H17NO and a molecular weight of 143.23 g/mol. Its IUPAC name is 4-ethyl-2-propan-2-yl-1,2-oxazolidine.
| Compound Name | 4-ethyl-2-propan-2-yl-1,2-oxazolidine |
|---|---|
| PubChem CID | 166717132 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | 4-ethyl-2-propan-2-yl-1,2-oxazolidine |
| SMILES | CCC1CON(C(C)C)C1 |
| InChI | InChI=1S/C8H17NO/c1-4-8-5-9(7(2)3)10-6-8/h7-8H,4-6H2,1-3H3 |
| InChIKey | RMWYASZMTNHKBH-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |