C19H26N2O3 — CID 166717960
methyl N-[2-[1-(3-methylphenyl)-3-azabicyclo[3.1.0]hexane-3-carbonyl]butyl]carbamate (PubChem CID 166717960) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is methyl N-[2-[1-(3-methylphenyl)-3-azabicyclo[3.1.0]hexane-3-carbonyl]butyl]carbamate.
| Compound Name | methyl N-[2-[1-(3-methylphenyl)-3-azabicyclo[3.1.0]hexane-3-carbonyl]butyl]carbamate |
|---|---|
| PubChem CID | 166717960 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | methyl N-[2-[1-(3-methylphenyl)-3-azabicyclo[3.1.0]hexane-3-carbonyl]butyl]carbamate |
| SMILES | CCC(CNC(=O)OC)C(=O)N1CC2CC2(c2cccc(C)c2)C1 |
| InChI | InChI=1S/C19H26N2O3/c1-4-14(10-20-18(23)24-3)17(22)21-11-16-9-19(16,12-21)15-7-5-6-13(2)8-15/h5-8,14,16H,4,9-12H2,1-3H3,(H,20,23) |
| InChIKey | KVQIAEKXGLNWAN-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |