C10H12F2S — CID 166718407
1,3-difluoro-5-methylsulfanyl-2-propan-2-ylbenzene (PubChem CID 166718407) has the molecular formula C10H12F2S and a molecular weight of 202.27 g/mol. Its IUPAC name is 1,3-difluoro-5-methylsulfanyl-2-propan-2-ylbenzene.
| Compound Name | 1,3-difluoro-5-methylsulfanyl-2-propan-2-ylbenzene |
|---|---|
| PubChem CID | 166718407 |
| Molecular Formula | C10H12F2S |
| Molecular Weight | 202.27 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | 1,3-difluoro-5-methylsulfanyl-2-propan-2-ylbenzene |
| SMILES | CSc1cc(F)c(C(C)C)c(F)c1 |
| InChI | InChI=1S/C10H12F2S/c1-6(2)10-8(11)4-7(13-3)5-9(10)12/h4-6H,1-3H3 |
| InChIKey | LDYMTSDESUMWMQ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.27 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |