C22H24N4O2 — CID 16672276
3-[1-(2-phenylbutanoyl)piperidin-4-yl]-1,2,3-benzotriazin-4-one (PubChem CID 16672276) has the molecular formula C22H24N4O2 and a molecular weight of 376.46 g/mol. Its IUPAC name is 3-[1-(2-phenylbutanoyl)piperidin-4-yl]-1,2,3-benzotriazin-4-one.
| Compound Name | 3-[1-(2-phenylbutanoyl)piperidin-4-yl]-1,2,3-benzotriazin-4-one |
|---|---|
| PubChem CID | 16672276 |
| Molecular Formula | C22H24N4O2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 3-[1-(2-phenylbutanoyl)piperidin-4-yl]-1,2,3-benzotriazin-4-one |
| SMILES | CCC(C(=O)N1CCC(n2nnc3ccccc3c2=O)CC1)c1ccccc1 |
| InChI | InChI=1S/C22H24N4O2/c1-2-18(16-8-4-3-5-9-16)21(27)25-14-12-17(13-15-25)26-22(28)19-10-6-7-11-20(19)23-24-26/h3-11,17-18H,2,12-15H2,1H3 |
| InChIKey | BKNRIWQFINIHMS-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |