C21H22N4O4 — CID 16669189
3-[1-(2,6-dimethoxybenzoyl)piperidin-4-yl]-1,2,3-benzotriazin-4-one (PubChem CID 16669189) has the molecular formula C21H22N4O4 and a molecular weight of 394.43 g/mol. Its IUPAC name is 3-[1-(2,6-dimethoxybenzoyl)piperidin-4-yl]-1,2,3-benzotriazin-4-one.
| Compound Name | 3-[1-(2,6-dimethoxybenzoyl)piperidin-4-yl]-1,2,3-benzotriazin-4-one |
|---|---|
| PubChem CID | 16669189 |
| Molecular Formula | C21H22N4O4 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 3-[1-(2,6-dimethoxybenzoyl)piperidin-4-yl]-1,2,3-benzotriazin-4-one |
| SMILES | COc1cccc(OC)c1C(=O)N1CCC(n2nnc3ccccc3c2=O)CC1 |
| InChI | InChI=1S/C21H22N4O4/c1-28-17-8-5-9-18(29-2)19(17)21(27)24-12-10-14(11-13-24)25-20(26)15-6-3-4-7-16(15)22-23-25/h3-9,14H,10-13H2,1-2H3 |
| InChIKey | SGLOCQNBYCDYJW-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 86.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |