C15H34N4O2 — CID 166723382
1-[(2S)-1-(2-methoxypropan-2-yloxy)propan-2-yl]-1,4,7,10-tetrazacyclododecane (PubChem CID 166723382) has the molecular formula C15H34N4O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is 1-[(2S)-1-(2-methoxypropan-2-yloxy)propan-2-yl]-1,4,7,10-tetrazacyclododecane.
| Compound Name | 1-[(2S)-1-(2-methoxypropan-2-yloxy)propan-2-yl]-1,4,7,10-tetrazacyclododecane |
|---|---|
| PubChem CID | 166723382 |
| Molecular Formula | C15H34N4O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.27 |
| IUPAC Name | 1-[(2S)-1-(2-methoxypropan-2-yloxy)propan-2-yl]-1,4,7,10-tetrazacyclododecane |
| SMILES | COC(C)(C)OC[C@H](C)N1CCNCCNCCNCC1 |
| InChI | InChI=1S/C15H34N4O2/c1-14(13-21-15(2,3)20-4)19-11-9-17-7-5-16-6-8-18-10-12-19/h14,16-18H,5-13H2,1-4H3/t14-/m0/s1 |
| InChIKey | HQDFGESBITXBPV-AWEZNQCLSA-N |
| XLogP | -0.14 |
| TPSA | 57.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|