C17H24Cl2N2 — CID 166724783
5,6-dichloro-1-(2-methylnonan-2-yl)benzimidazole (PubChem CID 166724783) has the molecular formula C17H24Cl2N2 and a molecular weight of 327.30 g/mol. Its IUPAC name is 5,6-dichloro-1-(2-methylnonan-2-yl)benzimidazole.
| Compound Name | 5,6-dichloro-1-(2-methylnonan-2-yl)benzimidazole |
|---|---|
| PubChem CID | 166724783 |
| Molecular Formula | C17H24Cl2N2 |
| Molecular Weight | 327.30 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 5,6-dichloro-1-(2-methylnonan-2-yl)benzimidazole |
| SMILES | CCCCCCCC(C)(C)n1cnc2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C17H24Cl2N2/c1-4-5-6-7-8-9-17(2,3)21-12-20-15-10-13(18)14(19)11-16(15)21/h10-12H,4-9H2,1-3H3 |
| InChIKey | BJUBJLDOMYILLB-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.30 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|