C20H37N3O2 — CID 166726660
2-[4-[5-methylidene-3-(3-methylpentan-3-yl)-2-oxopyrrolidin-1-yl]butylamino]-N-propylacetamide (PubChem CID 166726660) has the molecular formula C20H37N3O2 and a molecular weight of 351.54 g/mol. Its IUPAC name is 2-[4-[5-methylidene-3-(3-methylpentan-3-yl)-2-oxopyrrolidin-1-yl]butylamino]-N-propylacetamide.
| Compound Name | 2-[4-[5-methylidene-3-(3-methylpentan-3-yl)-2-oxopyrrolidin-1-yl]butylamino]-N-propylacetamide |
|---|---|
| PubChem CID | 166726660 |
| Molecular Formula | C20H37N3O2 |
| Molecular Weight | 351.54 g/mol |
| Exact Mass | 351.29 |
| IUPAC Name | 2-[4-[5-methylidene-3-(3-methylpentan-3-yl)-2-oxopyrrolidin-1-yl]butylamino]-N-propylacetamide |
| SMILES | C=C1CC(C(C)(CC)CC)C(=O)N1CCCCNCC(=O)NCCC |
| InChI | InChI=1S/C20H37N3O2/c1-6-11-22-18(24)15-21-12-9-10-13-23-16(4)14-17(19(23)25)20(5,7-2)8-3/h17,21H,4,6-15H2,1-3,5H3,(H,22,24) |
| InChIKey | CIKCUKLYVOFUIH-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.54 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|