C21H30N2O2 — CID 16672925
N-[(3R,4S)-4-(4-methoxyphenyl)-1-propylpyrrolidin-3-yl]cyclohex-3-ene-1-carboxamide (PubChem CID 16672925) has the molecular formula C21H30N2O2 and a molecular weight of 342.48 g/mol. Its IUPAC name is N-[(3R,4S)-4-(4-methoxyphenyl)-1-propylpyrrolidin-3-yl]cyclohex-3-ene-1-carboxamide.
| Compound Name | N-[(3R,4S)-4-(4-methoxyphenyl)-1-propylpyrrolidin-3-yl]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 16672925 |
| Molecular Formula | C21H30N2O2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | N-[(3R,4S)-4-(4-methoxyphenyl)-1-propylpyrrolidin-3-yl]cyclohex-3-ene-1-carboxamide |
| SMILES | CCCN1C[C@H](NC(=O)C2CC=CCC2)[C@@H](c2ccc(OC)cc2)C1 |
| InChI | InChI=1S/C21H30N2O2/c1-3-13-23-14-19(16-9-11-18(25-2)12-10-16)20(15-23)22-21(24)17-7-5-4-6-8-17/h4-5,9-12,17,19-20H,3,6-8,13-15H2,1-2H3,(H,22,24)/t17?,19-,20+/m1/s1 |
| InChIKey | DXNLEZMLMFJLPC-GQXIWKRZSA-N |
| XLogP | 3.35 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|