C23H34BrN3O5 — CID 166729398
tert-butyl 2-[[1-(5-bromo-1,3-oxazol-2-yl)-7-oxononyl]carbamoyl]-5-azaspiro[2.3]hexane-5-carboxylate (PubChem CID 166729398) has the molecular formula C23H34BrN3O5 and a molecular weight of 512.45 g/mol. Its IUPAC name is tert-butyl 2-[[1-(5-bromo-1,3-oxazol-2-yl)-7-oxononyl]carbamoyl]-5-azaspiro[2.3]hexane-5-carboxylate.
| Compound Name | tert-butyl 2-[[1-(5-bromo-1,3-oxazol-2-yl)-7-oxononyl]carbamoyl]-5-azaspiro[2.3]hexane-5-carboxylate |
|---|---|
| PubChem CID | 166729398 |
| Molecular Formula | C23H34BrN3O5 |
| Molecular Weight | 512.45 g/mol |
| Exact Mass | 511.17 |
| IUPAC Name | tert-butyl 2-[[1-(5-bromo-1,3-oxazol-2-yl)-7-oxononyl]carbamoyl]-5-azaspiro[2.3]hexane-5-carboxylate |
| SMILES | CCC(=O)CCCCCC(NC(=O)C1CC12CN(C(=O)OC(C)(C)C)C2)c1ncc(Br)o1 |
| InChI | InChI=1S/C23H34BrN3O5/c1-5-15(28)9-7-6-8-10-17(20-25-12-18(24)31-20)26-19(29)16-11-23(16)13-27(14-23)21(30)32-22(2,3)4/h12,16-17H,5-11,13-14H2,1-4H3,(H,26,29) |
| InChIKey | ZGLYTAJECPBAMN-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 101.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.45 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|