C25H25F2N3O4S — CID 166729528
4-[4-[3,3-difluoro-4-(thiiran-2-yl)piperidine-1-carbonyl]-3,5-dimethoxyphenyl]-2-methyl-2,7-naphthyridin-1-one (PubChem CID 166729528) has the molecular formula C25H25F2N3O4S and a molecular weight of 501.56 g/mol. Its IUPAC name is 4-[4-[3,3-difluoro-4-(thiiran-2-yl)piperidine-1-carbonyl]-3,5-dimethoxyphenyl]-2-methyl-2,7-naphthyridin-1-one.
| Compound Name | 4-[4-[3,3-difluoro-4-(thiiran-2-yl)piperidine-1-carbonyl]-3,5-dimethoxyphenyl]-2-methyl-2,7-naphthyridin-1-one |
|---|---|
| PubChem CID | 166729528 |
| Molecular Formula | C25H25F2N3O4S |
| Molecular Weight | 501.56 g/mol |
| Exact Mass | 501.15 |
| IUPAC Name | 4-[4-[3,3-difluoro-4-(thiiran-2-yl)piperidine-1-carbonyl]-3,5-dimethoxyphenyl]-2-methyl-2,7-naphthyridin-1-one |
| SMILES | COc1cc(-c2cn(C)c(=O)c3cnccc23)cc(OC)c1C(=O)N1CCC(C2CS2)C(F)(F)C1 |
| InChI | InChI=1S/C25H25F2N3O4S/c1-29-11-17(15-4-6-28-10-16(15)23(29)31)14-8-19(33-2)22(20(9-14)34-3)24(32)30-7-5-18(21-12-35-21)25(26,27)13-30/h4,6,8-11,18,21H,5,7,12-13H2,1-3H3 |
| InChIKey | KTYFUMXNLZOWME-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.56 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|