C20H19F3N2O3 — CID 166732587
2-(4-phenylmethoxy-1H-indol-3-yl)ethyl N-(2,2,2-trifluoroethyl)carbamate (PubChem CID 166732587) has the molecular formula C20H19F3N2O3 and a molecular weight of 392.38 g/mol. Its IUPAC name is 2-(4-phenylmethoxy-1H-indol-3-yl)ethyl N-(2,2,2-trifluoroethyl)carbamate.
| Compound Name | 2-(4-phenylmethoxy-1H-indol-3-yl)ethyl N-(2,2,2-trifluoroethyl)carbamate |
|---|---|
| PubChem CID | 166732587 |
| Molecular Formula | C20H19F3N2O3 |
| Molecular Weight | 392.38 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 2-(4-phenylmethoxy-1H-indol-3-yl)ethyl N-(2,2,2-trifluoroethyl)carbamate |
| SMILES | O=C(NCC(F)(F)F)OCCc1c[nH]c2cccc(OCc3ccccc3)c12 |
| InChI | InChI=1S/C20H19F3N2O3/c21-20(22,23)13-25-19(26)27-10-9-15-11-24-16-7-4-8-17(18(15)16)28-12-14-5-2-1-3-6-14/h1-8,11,24H,9-10,12-13H2,(H,25,26) |
| InChIKey | OUMHYCWIUPPOJT-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.38 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |