C22H18F3N5O3 — CID 174161231
N-[(E)-(4-phenylmethoxy-1H-indol-3-yl)methylideneamino]pyrimidin-2-amine;2,2,2-trifluoroacetic acid (PubChem CID 174161231) has the molecular formula C22H18F3N5O3 and a molecular weight of 457.41 g/mol. Its IUPAC name is N-[(E)-(4-phenylmethoxy-1H-indol-3-yl)methylideneamino]pyrimidin-2-amine;2,2,2-trifluoroacetic acid.
| Compound Name | N-[(E)-(4-phenylmethoxy-1H-indol-3-yl)methylideneamino]pyrimidin-2-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 174161231 |
| Molecular Formula | C22H18F3N5O3 |
| Molecular Weight | 457.41 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | N-[(E)-(4-phenylmethoxy-1H-indol-3-yl)methylideneamino]pyrimidin-2-amine;2,2,2-trifluoroacetic acid |
| SMILES | C(=N/Nc1ncccn1)\c1c[nH]c2cccc(OCc3ccccc3)c12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H17N5O.C2HF3O2/c1-2-6-15(7-3-1)14-26-18-9-4-8-17-19(18)16(12-23-17)13-24-25-20-21-10-5-11-22-20;3-2(4,5)1(6)7/h1-13,23H,14H2,(H,21,22,25);(H,6,7)/b24-13+; |
| InChIKey | XIMMXTNGBAZGPY-KEJAMGHHSA-N |
| XLogP | 4.62 |
| TPSA | 112.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.41 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|